C17H27N3 — CID 91102247
(8S)-3,7-diethyl-2,8-dimethyl-3,4,5,5a,6,7,8,10-octahydropyrido[2,3-b][1,8]naphthyridine (PubChem CID 91102247) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (8S)-3,7-diethyl-2,8-dimethyl-3,4,5,5a,6,7,8,10-octahydropyrido[2,3-b][1,8]naphthyridine.
| Compound Name | (8S)-3,7-diethyl-2,8-dimethyl-3,4,5,5a,6,7,8,10-octahydropyrido[2,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 91102247 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (8S)-3,7-diethyl-2,8-dimethyl-3,4,5,5a,6,7,8,10-octahydropyrido[2,3-b][1,8]naphthyridine |
| SMILES | CCC1CC2=C(N=C1C)NC1=N[C@@H](C)C(CC)CC1C2 |
| InChI | InChI=1S/C17H27N3/c1-5-12-7-14-9-15-8-13(6-2)11(4)19-17(15)20-16(14)18-10(12)3/h10,12-14H,5-9H2,1-4H3,(H,18,20)/t10-,12?,13?,14?/m0/s1 |
| InChIKey | FXCASGNAMFAFAH-ZPQSCOJMSA-N |
| XLogP | 3.92 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |