C13H21N3 — CID 136617439
3-ethyl-N,6,7-trimethyl-3,4,5,6-tetrahydro-1H-1,8-naphthyridin-2-imine (PubChem CID 136617439) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-ethyl-N,6,7-trimethyl-3,4,5,6-tetrahydro-1H-1,8-naphthyridin-2-imine.
| Compound Name | 3-ethyl-N,6,7-trimethyl-3,4,5,6-tetrahydro-1H-1,8-naphthyridin-2-imine |
|---|---|
| PubChem CID | 136617439 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-ethyl-N,6,7-trimethyl-3,4,5,6-tetrahydro-1H-1,8-naphthyridin-2-imine |
| SMILES | CCC1CC2=C(N=C(C)C(C)C2)N/C1=N/C |
| InChI | InChI=1S/C13H21N3/c1-5-10-7-11-6-8(2)9(3)15-13(11)16-12(10)14-4/h8,10H,5-7H2,1-4H3,(H,14,16) |
| InChIKey | VBCRRAKVPPRMRO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|