C15H22N4 — CID 137100475
N,3,7,8-tetramethyl-3,4,5,5a,6,9-hexahydro-1H-pyrido[2,3-b][1,8]naphthyridin-2-imine (PubChem CID 137100475) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N,3,7,8-tetramethyl-3,4,5,5a,6,9-hexahydro-1H-pyrido[2,3-b][1,8]naphthyridin-2-imine.
| Compound Name | N,3,7,8-tetramethyl-3,4,5,5a,6,9-hexahydro-1H-pyrido[2,3-b][1,8]naphthyridin-2-imine |
|---|---|
| PubChem CID | 137100475 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N,3,7,8-tetramethyl-3,4,5,5a,6,9-hexahydro-1H-pyrido[2,3-b][1,8]naphthyridin-2-imine |
| SMILES | C/N=C1/NC2=C(CC3CC(C)=C(C)NC3=N2)CC1C |
| InChI | InChI=1S/C15H22N4/c1-8-5-11-7-12-6-9(2)13(16-4)18-15(12)19-14(11)17-10(8)3/h9,11H,5-7H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | JELRIEFKLXEKLD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|