C14H20N4 — CID 90961072
3,7,8-trimethyl-3,4,5,5a,6,9-hexahydropyrido[2,3-b][1,8]naphthyridin-2-amine (PubChem CID 90961072) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3,7,8-trimethyl-3,4,5,5a,6,9-hexahydropyrido[2,3-b][1,8]naphthyridin-2-amine.
| Compound Name | 3,7,8-trimethyl-3,4,5,5a,6,9-hexahydropyrido[2,3-b][1,8]naphthyridin-2-amine |
|---|---|
| PubChem CID | 90961072 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3,7,8-trimethyl-3,4,5,5a,6,9-hexahydropyrido[2,3-b][1,8]naphthyridin-2-amine |
| SMILES | CC1=C(C)NC2=NC3=C(CC(C)C(N)=N3)CC2C1 |
| InChI | InChI=1S/C14H20N4/c1-7-4-10-6-11-5-8(2)12(15)17-14(11)18-13(10)16-9(7)3/h8,10H,4-6H2,1-3H3,(H2,15,17)(H,16,18) |
| InChIKey | VJEFSNWPJKKDMQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |