C17H26N2S — CID 106477265
2-(4-propylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477265) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 2-(4-propylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-(4-propylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477265 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-(4-propylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | CCCC1CCC(c2nc(=S)c3c([nH]2)CCCC3)CC1 |
| InChI | InChI=1S/C17H26N2S/c1-2-5-12-8-10-13(11-9-12)16-18-15-7-4-3-6-14(15)17(20)19-16/h12-13H,2-11H2,1H3,(H,18,19,20) |
| InChIKey | MODBVCTXSAPIII-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|