C17H26N2S — CID 106477165
2-(4-propan-2-ylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477165) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 2-(4-propan-2-ylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-(4-propan-2-ylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477165 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-(4-propan-2-ylcyclohexyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | CC(C)C1CCC(c2nc(=S)c3c([nH]2)CCCC3)CC1 |
| InChI | InChI=1S/C17H26N2S/c1-11(2)12-7-9-13(10-8-12)16-18-15-6-4-3-5-14(15)17(20)19-16/h11-13H,3-10H2,1-2H3,(H,18,19,20) |
| InChIKey | OSNLDYWPALSIBF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|