C18H15BrN2O5 — CID 91102706
[(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] acetate (PubChem CID 91102706) has the molecular formula C18H15BrN2O5 and a molecular weight of 419.23 g/mol. Its IUPAC name is [(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] acetate.
| Compound Name | [(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] acetate |
|---|---|
| PubChem CID | 91102706 |
| Molecular Formula | C18H15BrN2O5 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | [(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] acetate |
| SMILES | CC(=O)ON(Cc1ccc(Br)o1)C(=O)c1oc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C18H15BrN2O5/c1-11-16(25-17(20-11)13-6-4-3-5-7-13)18(23)21(26-12(2)22)10-14-8-9-15(19)24-14/h3-9H,10H2,1-2H3 |
| InChIKey | HUIFAISUYGZNAK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|