C26H27FN2O5 — CID 143649877
2-[[5-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]furan-2-yl]methyl-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid (PubChem CID 143649877) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-[[5-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]furan-2-yl]methyl-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[5-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]furan-2-yl]methyl-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 143649877 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[[5-[(3Z,5Z)-4-fluorohepta-1,3,5-trien-3-yl]furan-2-yl]methyl-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3-oxazole-5-carbonyl]amino]acetic acid |
| SMILES | C=C/C=C\C(=C/C)c1nc(C)c(C(=O)N(CC(=O)O)Cc2ccc(/C(C=C)=C(F)/C=C\C)o2)o1 |
| InChI | InChI=1S/C26H27FN2O5/c1-6-10-12-18(8-3)25-28-17(5)24(34-25)26(32)29(16-23(30)31)15-19-13-14-22(33-19)20(9-4)21(27)11-7-2/h6-14H,1,4,15-16H2,2-3,5H3,(H,30,31)/b11-7-,12-10-,18-8+,21-20- |
| InChIKey | JMSCDRYUJHWYMV-NBDWDDPNSA-N |
| XLogP | 5.89 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|