C19H17BrN2O5 — CID 91598772
[(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] propanoate (PubChem CID 91598772) has the molecular formula C19H17BrN2O5 and a molecular weight of 433.26 g/mol. Its IUPAC name is [(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] propanoate.
| Compound Name | [(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] propanoate |
|---|---|
| PubChem CID | 91598772 |
| Molecular Formula | C19H17BrN2O5 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [(5-bromofuran-2-yl)methyl-(4-methyl-2-phenyl-1,3-oxazole-5-carbonyl)amino] propanoate |
| SMILES | CCC(=O)ON(Cc1ccc(Br)o1)C(=O)c1oc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C19H17BrN2O5/c1-3-16(23)27-22(11-14-9-10-15(20)25-14)19(24)17-12(2)21-18(26-17)13-7-5-4-6-8-13/h4-10H,3,11H2,1-2H3 |
| InChIKey | SMJYUSFDPVGACA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|