C18H40O3Si — CID 91102793
(3-ethyl-4,4-dimethylpentan-2-yl)-tri(propan-2-yloxy)silane (PubChem CID 91102793) has the molecular formula C18H40O3Si and a molecular weight of 332.60 g/mol. Its IUPAC name is (3-ethyl-4,4-dimethylpentan-2-yl)-tri(propan-2-yloxy)silane.
| Compound Name | (3-ethyl-4,4-dimethylpentan-2-yl)-tri(propan-2-yloxy)silane |
|---|---|
| PubChem CID | 91102793 |
| Molecular Formula | C18H40O3Si |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (3-ethyl-4,4-dimethylpentan-2-yl)-tri(propan-2-yloxy)silane |
| SMILES | CCC(C(C)[Si](OC(C)C)(OC(C)C)OC(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H40O3Si/c1-12-17(18(9,10)11)16(8)22(19-13(2)3,20-14(4)5)21-15(6)7/h13-17H,12H2,1-11H3 |
| InChIKey | STWUTARCZQREHJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|