C15H11F2NO — CID 91103901
2-[(2,4-difluorophenyl)methyl]isoindol-1-ol (PubChem CID 91103901) has the molecular formula C15H11F2NO and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]isoindol-1-ol.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91103901 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]isoindol-1-ol |
| SMILES | Oc1c2ccccc2cn1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H11F2NO/c16-12-6-5-11(14(17)7-12)9-18-8-10-3-1-2-4-13(10)15(18)19/h1-8,19H,9H2 |
| InChIKey | YRRLNLMVQGUPCX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |