C24H27ClN2O3 — CID 91104196
4-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]butanamide (PubChem CID 91104196) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]butanamide |
|---|---|
| PubChem CID | 91104196 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 4-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]butanamide |
| SMILES | COc1ccc2c(c1)C(CC(=O)c1ccc(NC(=O)CCCCl)cc1)=NC(C)(C)C2 |
| InChI | InChI=1S/C24H27ClN2O3/c1-24(2)15-17-8-11-19(30-3)13-20(17)21(27-24)14-22(28)16-6-9-18(10-7-16)26-23(29)5-4-12-25/h6-11,13H,4-5,12,14-15H2,1-3H3,(H,26,29) |
| InChIKey | QKSXNYYCYLYNSW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|