C25H30N2O3 — CID 91303616
N-[4-[2-(6-methoxy-3,3-dimethylisoindol-1-yl)acetyl]phenyl]hexanamide (PubChem CID 91303616) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[4-[2-(6-methoxy-3,3-dimethylisoindol-1-yl)acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-(6-methoxy-3,3-dimethylisoindol-1-yl)acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 91303616 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[4-[2-(6-methoxy-3,3-dimethylisoindol-1-yl)acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)CC2=NC(C)(C)c3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-5-6-7-8-24(29)26-18-11-9-17(10-12-18)23(28)16-22-20-15-19(30-4)13-14-21(20)25(2,3)27-22/h9-15H,5-8,16H2,1-4H3,(H,26,29) |
| InChIKey | CTWWKYZIBFNROH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|