C23H25NO4 — CID 91200729
4-[2-(7-methoxy-3,3,4,4-tetramethylisoquinolin-1-yl)acetyl]benzoic acid (PubChem CID 91200729) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[2-(7-methoxy-3,3,4,4-tetramethylisoquinolin-1-yl)acetyl]benzoic acid.
| Compound Name | 4-[2-(7-methoxy-3,3,4,4-tetramethylisoquinolin-1-yl)acetyl]benzoic acid |
|---|---|
| PubChem CID | 91200729 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[2-(7-methoxy-3,3,4,4-tetramethylisoquinolin-1-yl)acetyl]benzoic acid |
| SMILES | COc1ccc2c(c1)C(CC(=O)c1ccc(C(=O)O)cc1)=NC(C)(C)C2(C)C |
| InChI | InChI=1S/C23H25NO4/c1-22(2)18-11-10-16(28-5)12-17(18)19(24-23(22,3)4)13-20(25)14-6-8-15(9-7-14)21(26)27/h6-12H,13H2,1-5H3,(H,26,27) |
| InChIKey | SRPIRYWFSGFBMS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |