C43H71B60N4O7 — CID 91104326
CID 91104326 (PubChem CID 91104326) has the molecular formula C43H71B60N4O7 and a molecular weight of 1404.78 g/mol.
| Compound Name | CID 91104326 |
|---|---|
| PubChem CID | 91104326 |
| Molecular Formula | C43H71B60N4O7 |
| Molecular Weight | 1404.78 g/mol |
| Exact Mass | 1416.09 |
| IUPAC Name | — |
| SMILES | CNC(CCCCNC(=O)CCC(C)C1CCC2C3CC[C@H]4C[C@@H](O)CC[C@@]4(C)C3CC[C@@]12C)C(=O)NC(C(=O)N(C)Cc1ccccc1B(O)O)C(C)O.[B]B([B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].[B][B]B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C43H71BN4O7.B30.B29/c1-27(33-17-18-34-32-16-15-30-25-31(50)20-22-42(30,3)35(32)21-23-43(33,34)4)14-19-38(51)46-24-10-9-13-37(45-5)40(52)47-39(28(2)49)41(53)48(6)26-29-11-7-8-12-36(29)44(54)55;1-17(2)25(18(3)4)29(26(19(5)6)20(7)8)30(27(21(9)10)22(11)12)28(23(13)14)24(15)16;1-16-24(17(2)3)28(25(18(4)5)19(6)7)29(26(20(8)9)21(10)11)27(22(12)13)23(14)15/h7-8,11-12,27-28,30-35,37,39,45,49-50,54-55H,9-10,13-26H2,1-6H3,(H,46,51)(H,47,52);;/t27?,28?,30-,31-,32?,33?,34?,35?,37?,39?,42+,43-;;/m0../s1 |
| InChIKey | ZMVMNQROMGFFRP-LHYXWBMWSA-N |
| XLogP | -18.97 |
| TPSA | 171.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 114 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1404.78 |
| LogP ≤ 5 | -18.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|