C15H23N5O4 — CID 9110458
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide (PubChem CID 9110458) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 9110458 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
| SMILES | Cc1nn(CC(=O)NC(=O)N[C@@H]2CCCC[C@@H]2C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N5O4/c1-9-6-4-5-7-12(9)16-15(22)17-13(21)8-19-11(3)14(20(23)24)10(2)18-19/h9,12H,4-8H2,1-3H3,(H2,16,17,21,22)/t9-,12+/m0/s1 |
| InChIKey | FZHGQUYIWVOYQD-JOYOIKCWSA-N |
| XLogP | 1.81 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|