C34H29N3O3S2 — CID 91105384
5-[[4-[4-(3-methyl-3-bicyclo[3.2.0]heptanyl)-1,3-thiazol-2-yl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91105384) has the molecular formula C34H29N3O3S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is 5-[[4-[4-(3-methyl-3-bicyclo[3.2.0]heptanyl)-1,3-thiazol-2-yl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-[4-(3-methyl-3-bicyclo[3.2.0]heptanyl)-1,3-thiazol-2-yl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91105384 |
| Molecular Formula | C34H29N3O3S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | 5-[[4-[4-(3-methyl-3-bicyclo[3.2.0]heptanyl)-1,3-thiazol-2-yl]phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC1(c2csc(-c3ccc(C=C4C(=O)NC(=S)N(c5ccc(Oc6ccccc6)cc5)C4=O)cc3)n2)CC2CCC2C1 |
| InChI | InChI=1S/C34H29N3O3S2/c1-34(18-23-11-12-24(23)19-34)29-20-42-31(35-29)22-9-7-21(8-10-22)17-28-30(38)36-33(41)37(32(28)39)25-13-15-27(16-14-25)40-26-5-3-2-4-6-26/h2-10,13-17,20,23-24H,11-12,18-19H2,1H3,(H,36,38,41) |
| InChIKey | BVIQXLHUSFYVKJ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|