C20H30O5 — CID 91105548
7-[2-[(3S)-3-hydroxyoctyl]-3,5-dioxocyclopenten-1-yl]hept-5-enoic acid (PubChem CID 91105548) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 7-[2-[(3S)-3-hydroxyoctyl]-3,5-dioxocyclopenten-1-yl]hept-5-enoic acid.
| Compound Name | 7-[2-[(3S)-3-hydroxyoctyl]-3,5-dioxocyclopenten-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91105548 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-[2-[(3S)-3-hydroxyoctyl]-3,5-dioxocyclopenten-1-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](O)CCC1=C(CC=CCCCC(=O)O)C(=O)CC1=O |
| InChI | InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,15,21H,2-3,5-6,8-14H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | IZJUSIQTDKQWFN-HNNXBMFYSA-N |
| XLogP | 3.75 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|