C15H28 — CID 91106501
4,5,6,7,8-pentamethyldec-2-yne (PubChem CID 91106501) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 4,5,6,7,8-pentamethyldec-2-yne.
| Compound Name | 4,5,6,7,8-pentamethyldec-2-yne |
|---|---|
| PubChem CID | 91106501 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 4,5,6,7,8-pentamethyldec-2-yne |
| SMILES | CC#CC(C)C(C)C(C)C(C)C(C)CC |
| InChI | InChI=1S/C15H28/c1-8-10-12(4)14(6)15(7)13(5)11(3)9-2/h11-15H,9H2,1-7H3 |
| InChIKey | IKPAJYZHMZZKMA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|