C16H26O4 — CID 91107913
(4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-3-methyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 91107913) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-3-methyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-3-methyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 91107913 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (4R,5R,6aS)-5-hydroxy-4-(3-hydroxy-3-methyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCC(C)(O)C=C[C@@H]1C2CC(=O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C16H26O4/c1-3-4-5-7-16(2,19)8-6-11-12-9-15(18)20-14(12)10-13(11)17/h6,8,11-14,17,19H,3-5,7,9-10H2,1-2H3/t11-,12?,13-,14+,16?/m1/s1 |
| InChIKey | NIIHXQWNWCEOEC-JCLLTIBYSA-N |
| XLogP | 2.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|