C19H21N3O5 — CID 9110835
2-methoxy-N-[4-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]oxyphenyl]benzamide (PubChem CID 9110835) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-methoxy-N-[4-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]oxyphenyl]benzamide.
| Compound Name | 2-methoxy-N-[4-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 9110835 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-methoxy-N-[4-[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]oxyphenyl]benzamide |
| SMILES | CNC(=O)NC(=O)[C@H](C)Oc1ccc(NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C19H21N3O5/c1-12(17(23)22-19(25)20-2)27-14-10-8-13(9-11-14)21-18(24)15-6-4-5-7-16(15)26-3/h4-12H,1-3H3,(H,21,24)(H2,20,22,23,25)/t12-/m0/s1 |
| InChIKey | WRKAHYXEVBXGOJ-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |