C22H18F4N2O3 — CID 91109085
ethyl 2-[6-amino-3-[[2,2-difluoro-2-(4-fluoronaphthalen-1-yl)acetyl]amino]-2-fluorophenyl]acetate (PubChem CID 91109085) has the molecular formula C22H18F4N2O3 and a molecular weight of 434.39 g/mol. Its IUPAC name is ethyl 2-[6-amino-3-[[2,2-difluoro-2-(4-fluoronaphthalen-1-yl)acetyl]amino]-2-fluorophenyl]acetate.
| Compound Name | ethyl 2-[6-amino-3-[[2,2-difluoro-2-(4-fluoronaphthalen-1-yl)acetyl]amino]-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 91109085 |
| Molecular Formula | C22H18F4N2O3 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | ethyl 2-[6-amino-3-[[2,2-difluoro-2-(4-fluoronaphthalen-1-yl)acetyl]amino]-2-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1c(N)ccc(NC(=O)C(F)(F)c2ccc(F)c3ccccc23)c1F |
| InChI | InChI=1S/C22H18F4N2O3/c1-2-31-19(29)11-14-17(27)9-10-18(20(14)24)28-21(30)22(25,26)15-7-8-16(23)13-6-4-3-5-12(13)15/h3-10H,2,11,27H2,1H3,(H,28,30) |
| InChIKey | DJQOVXIGWQVSAK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|