C15H13NO2 — CID 91111325
spiro[1-benzazepine-4,3'-cyclopentene]-3-carboxylic acid (PubChem CID 91111325) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is spiro[1-benzazepine-4,3'-cyclopentene]-3-carboxylic acid.
| Compound Name | spiro[1-benzazepine-4,3'-cyclopentene]-3-carboxylic acid |
|---|---|
| PubChem CID | 91111325 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | spiro[1-benzazepine-4,3'-cyclopentene]-3-carboxylic acid |
| SMILES | O=C(O)C1=CN=c2ccccc2=CC12C=CCC2 |
| InChI | InChI=1S/C15H13NO2/c17-14(18)12-10-16-13-6-2-1-5-11(13)9-15(12)7-3-4-8-15/h1-3,5-7,9-10H,4,8H2,(H,17,18) |
| InChIKey | LUMZCNRMBUQVMW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|