cyclohepta[f]indole-3-carboxylic acid

C14H9NO2 — CID 118865250

IUPACcyclohepta[f]indole-3-carboxylic acid
SMILESO=C(O)c1cnc2cc3cccccc3cc12
InChIInChI=1S/C14H9NO2/c16-14(17)12-8-15-13-7-10-5-3-1-2-4-9(10)6-11(12)13/h1-8H,(H,16,17)
InChIKeySKWZDFNYHTWVEP-UHFFFAOYSA-N
MW223.23 g/mol
LogP3.09
Rot. Bonds1

About cyclohepta[f]indole-3-carboxylic acid

cyclohepta[f]indole-3-carboxylic acid (PubChem CID 118865250) has the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. Its IUPAC name is cyclohepta[f]indole-3-carboxylic acid.

Molecular Properties

Compound Namecyclohepta[f]indole-3-carboxylic acid
PubChem CID118865250
Molecular FormulaC14H9NO2
Molecular Weight223.23 g/mol
Exact Mass223.06
IUPAC Namecyclohepta[f]indole-3-carboxylic acid
SMILESO=C(O)c1cnc2cc3cccccc3cc12
InChIInChI=1S/C14H9NO2/c16-14(17)12-8-15-13-7-10-5-3-1-2-4-9(10)6-11(12)13/h1-8H,(H,16,17)
InChIKeySKWZDFNYHTWVEP-UHFFFAOYSA-N
XLogP3.09
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze cyclohepta[f]indole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Cyclohepta[f]indole-3-carboxylic acid;2,2,2-trifluoroacetic acid
CID 172743610
Pyrroloanthrone-1-carboxylic acid
CID 129785130
7H-indole-5-carboxylic acid
CID 68328702
Cyclopenta[b]pyrrole-3-carboxylic acid
CID 69870816
7H-indole-3-carboxylic acid
CID 69927599
7H-indeno[2,1-c]pyridine-4-carboxylic acid
CID 87879625
Spiro[1-benzazepine-4,3'-cyclopentene]-3-carboxylic acid
CID 91111325
Cyclohepta[f]indole-3-carboxylic acid;hydrochloride
CID 118865263
6-Oxoisoindole-1-carboxylic acid
CID 141169058
4H-cyclopenta[b]pyridine-3-carboxylic acid;hydrochloride
CID 141286935
4H-cyclopenta[b]pyridine-3-carboxylic acid
CID 141286936
Methyl cyclohepta[f]indole-3-carboxylate
CID 141366427

Frequently Asked Questions

What is the IUPAC name of cyclohepta[f]indole-3-carboxylic acid?
The IUPAC name of cyclohepta[f]indole-3-carboxylic acid (CID 118865250) is cyclohepta[f]indole-3-carboxylic acid.
What is the SMILES notation for cyclohepta[f]indole-3-carboxylic acid?
The canonical SMILES for cyclohepta[f]indole-3-carboxylic acid is O=C(O)c1cnc2cc3cccccc3cc12.
What is the InChIKey of cyclohepta[f]indole-3-carboxylic acid?
The InChIKey is SKWZDFNYHTWVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2/c16-14(17)12-8-15-13-7-10-5-3-1-2-4-9(10)6-11(12)13/h1-8H,(H,16,17).
What are the key properties of cyclohepta[f]indole-3-carboxylic acid?
cyclohepta[f]indole-3-carboxylic acid has a molecular weight of 223.23 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[f]indole-3-carboxylic acid is sourced from PubChem (CID 118865250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).