C19H31FO3S — CID 91111644
(3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 91111644) has the molecular formula C19H31FO3S and a molecular weight of 358.52 g/mol. Its IUPAC name is (3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 91111644 |
| Molecular Formula | C19H31FO3S |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3aR,4S,7aS)-1-[(2R)-5-tert-butylsulfonyl-5-fluoropent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](CC=C(F)S(=O)(=O)C(C)(C)C)C1=CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C19H31FO3S/c1-13(8-11-17(20)24(22,23)18(2,3)4)14-9-10-15-16(21)7-6-12-19(14,15)5/h9,11,13,15-16,21H,6-8,10,12H2,1-5H3/t13-,15+,16+,19-/m1/s1 |
| InChIKey | PPWIWRJGKYUPFB-FVQSIRDASA-N |
| XLogP | 4.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|