C15H18O6 — CID 91112068
5-(2,3-diethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid (PubChem CID 91112068) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 5-(2,3-diethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid.
| Compound Name | 5-(2,3-diethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 91112068 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-(2,3-diethoxy-3-oxoprop-1-enyl)-2-methoxybenzoic acid |
| SMILES | CCOC(=O)C(=Cc1ccc(OC)c(C(=O)O)c1)OCC |
| InChI | InChI=1S/C15H18O6/c1-4-20-13(15(18)21-5-2)9-10-6-7-12(19-3)11(8-10)14(16)17/h6-9H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | OXENPTLVSGSCAD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|