C19H15F3N2O2 — CID 91114140
2-(1-methylindol-5-yl)-6-(2,2,2-trifluoroethoxy)isoindol-1-ol (PubChem CID 91114140) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-(1-methylindol-5-yl)-6-(2,2,2-trifluoroethoxy)isoindol-1-ol.
| Compound Name | 2-(1-methylindol-5-yl)-6-(2,2,2-trifluoroethoxy)isoindol-1-ol |
|---|---|
| PubChem CID | 91114140 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(1-methylindol-5-yl)-6-(2,2,2-trifluoroethoxy)isoindol-1-ol |
| SMILES | Cn1ccc2cc(-n3cc4ccc(OCC(F)(F)F)cc4c3O)ccc21 |
| InChI | InChI=1S/C19H15F3N2O2/c1-23-7-6-12-8-14(3-5-17(12)23)24-10-13-2-4-15(9-16(13)18(24)25)26-11-19(20,21)22/h2-10,25H,11H2,1H3 |
| InChIKey | AVQPFNYBDJKRHW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 39.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |