C11H16N2O2 — CID 91114198
1-propyl-5,6,7,8-tetrahydroquinazoline-2,4-dione (PubChem CID 91114198) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-propyl-5,6,7,8-tetrahydroquinazoline-2,4-dione.
| Compound Name | 1-propyl-5,6,7,8-tetrahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 91114198 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-propyl-5,6,7,8-tetrahydroquinazoline-2,4-dione |
| SMILES | CCCn1c2c(c(=O)[nH]c1=O)CCCC2 |
| InChI | InChI=1S/C11H16N2O2/c1-2-7-13-9-6-4-3-5-8(9)10(14)12-11(13)15/h2-7H2,1H3,(H,12,14,15) |
| InChIKey | IGFQKKQLUWDTPH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |