About 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene
5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene (PubChem CID 91115113) has the molecular formula C7H9BrClF3S
and a molecular weight of 297.57 g/mol. Its IUPAC name is 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene |
| PubChem CID | 91115113 |
| Molecular Formula | C7H9BrClF3S |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 295.92 |
| IUPAC Name | 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene |
| SMILES | CCSCC=CC(F)(Cl)C(F)(F)Br |
| InChI | InChI=1S/C7H9BrClF3S/c1-2-13-5-3-4-6(9,10)7(8,11)12/h3-4H,2,5H2,1H3 |
| InChIKey | IPJHHVBSGROJCU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene?
The IUPAC name of 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene (CID 91115113) is 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene.
What is the SMILES notation for 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene?
The canonical SMILES for 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene is CCSCC=CC(F)(Cl)C(F)(F)Br.
What is the InChIKey of 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene?
The InChIKey is IPJHHVBSGROJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrClF3S/c1-2-13-5-3-4-6(9,10)7(8,11)12/h3-4H,2,5H2,1H3.
What are the key properties of 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene?
5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene has a molecular weight of 297.57 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-1-ethylsulfanyl-4,5,5-trifluoropent-2-ene is sourced from PubChem (CID 91115113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).