C10H17ClO2 — CID 911155
2-chloro-1-[(2S,4R)-2-ethyl-2-methyloxan-4-yl]ethanone (PubChem CID 911155) has the molecular formula C10H17ClO2 and a molecular weight of 204.70 g/mol. Its IUPAC name is 2-chloro-1-[(2S,4R)-2-ethyl-2-methyloxan-4-yl]ethanone.
| Compound Name | 2-chloro-1-[(2S,4R)-2-ethyl-2-methyloxan-4-yl]ethanone |
|---|---|
| PubChem CID | 911155 |
| Molecular Formula | C10H17ClO2 |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-chloro-1-[(2S,4R)-2-ethyl-2-methyloxan-4-yl]ethanone |
| SMILES | CC[C@@]1(C)C[C@H](C(=O)CCl)CCO1 |
| InChI | InChI=1S/C10H17ClO2/c1-3-10(2)6-8(4-5-13-10)9(12)7-11/h8H,3-7H2,1-2H3/t8-,10+/m1/s1 |
| InChIKey | UISLDXZDDYXBAV-SCZZXKLOSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|