C26H31O7P — CID 91115614
diethoxyphosphoryl-[4-(methoxymethoxy)-3-[(4-phenoxyphenyl)methyl]phenyl]methanol (PubChem CID 91115614) has the molecular formula C26H31O7P and a molecular weight of 486.50 g/mol. Its IUPAC name is diethoxyphosphoryl-[4-(methoxymethoxy)-3-[(4-phenoxyphenyl)methyl]phenyl]methanol.
| Compound Name | diethoxyphosphoryl-[4-(methoxymethoxy)-3-[(4-phenoxyphenyl)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 91115614 |
| Molecular Formula | C26H31O7P |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | diethoxyphosphoryl-[4-(methoxymethoxy)-3-[(4-phenoxyphenyl)methyl]phenyl]methanol |
| SMILES | CCOP(=O)(OCC)C(O)c1ccc(OCOC)c(Cc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H31O7P/c1-4-31-34(28,32-5-2)26(27)21-13-16-25(30-19-29-3)22(18-21)17-20-11-14-24(15-12-20)33-23-9-7-6-8-10-23/h6-16,18,26-27H,4-5,17,19H2,1-3H3 |
| InChIKey | YLSDURWFKOHSBL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|