C10H22NOP — CID 91116481
ethane;2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 91116481) has the molecular formula C10H22NOP and a molecular weight of 203.27 g/mol. Its IUPAC name is ethane;2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | ethane;2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 91116481 |
| Molecular Formula | C10H22NOP |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | ethane;2-phosphanyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CC.OC1CCC2CN(P)CC2C1 |
| InChI | InChI=1S/C8H16NOP.C2H6/c10-8-2-1-6-4-9(11)5-7(6)3-8;1-2/h6-8,10H,1-5,11H2;1-2H3 |
| InChIKey | JAQIILRITSIEHG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|