C22H30N4O3 — CID 91119794
2-(2-aminoethoxymethyl)-N-ethyl-7,7-dimethyl-5-oxo-4-pyridin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 91119794) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-(2-aminoethoxymethyl)-N-ethyl-7,7-dimethyl-5-oxo-4-pyridin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2-(2-aminoethoxymethyl)-N-ethyl-7,7-dimethyl-5-oxo-4-pyridin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 91119794 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-(2-aminoethoxymethyl)-N-ethyl-7,7-dimethyl-5-oxo-4-pyridin-3-yl-4,4a,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCNC(=O)C1=C(COCCN)N=C2CC(C)(C)CC(=O)C2C1c1cccnc1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-25-21(28)20-16(13-29-9-7-23)26-15-10-22(2,3)11-17(27)19(15)18(20)14-6-5-8-24-12-14/h5-6,8,12,18-19H,4,7,9-11,13,23H2,1-3H3,(H,25,28) |
| InChIKey | GXEPCTRFHOIVCJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|