C32H37BrN2O3 — CID 91121742
1-benzyl-2-(2-bromophenyl)-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-3-pentylpyrrolidine-3-carboxamide (PubChem CID 91121742) has the molecular formula C32H37BrN2O3 and a molecular weight of 577.56 g/mol. Its IUPAC name is 1-benzyl-2-(2-bromophenyl)-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-3-pentylpyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-2-(2-bromophenyl)-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-3-pentylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91121742 |
| Molecular Formula | C32H37BrN2O3 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 1-benzyl-2-(2-bromophenyl)-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-3-pentylpyrrolidine-3-carboxamide |
| SMILES | CCCCCC1(C(=O)NCCc2ccc(OC)cc2)CC(=O)N(Cc2ccccc2)C1c1ccccc1Br |
| InChI | InChI=1S/C32H37BrN2O3/c1-3-4-10-20-32(31(37)34-21-19-24-15-17-26(38-2)18-16-24)22-29(36)35(23-25-11-6-5-7-12-25)30(32)27-13-8-9-14-28(27)33/h5-9,11-18,30H,3-4,10,19-23H2,1-2H3,(H,34,37) |
| InChIKey | IYGBRNGTMIMTHN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|