C23H26INO3S — CID 56958530
methyl (2R,3R)-1-benzyl-3-butylsulfanyl-2-(2-iodophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 56958530) has the molecular formula C23H26INO3S and a molecular weight of 523.44 g/mol. Its IUPAC name is methyl (2R,3R)-1-benzyl-3-butylsulfanyl-2-(2-iodophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (2R,3R)-1-benzyl-3-butylsulfanyl-2-(2-iodophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 56958530 |
| Molecular Formula | C23H26INO3S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | methyl (2R,3R)-1-benzyl-3-butylsulfanyl-2-(2-iodophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCS[C@]1(C(=O)OC)CC(=O)N(Cc2ccccc2)[C@@H]1c1ccccc1I |
| InChI | InChI=1S/C23H26INO3S/c1-3-4-14-29-23(22(27)28-2)15-20(26)25(16-17-10-6-5-7-11-17)21(23)18-12-8-9-13-19(18)24/h5-13,21H,3-4,14-16H2,1-2H3/t21-,23-/m1/s1 |
| InChIKey | OIFJIQJKLNBGFF-FYYLOGMGSA-N |
| XLogP | 5.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|