C28H30N4O8 — CID 91122422
[2-[amino-[hydrazinyl(methyl)amino]methyl]-3,5-dibenzoyloxy-6-hydroxyoxan-4-yl] benzoate (PubChem CID 91122422) has the molecular formula C28H30N4O8 and a molecular weight of 550.57 g/mol. Its IUPAC name is [2-[amino-[hydrazinyl(methyl)amino]methyl]-3,5-dibenzoyloxy-6-hydroxyoxan-4-yl] benzoate.
| Compound Name | [2-[amino-[hydrazinyl(methyl)amino]methyl]-3,5-dibenzoyloxy-6-hydroxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 91122422 |
| Molecular Formula | C28H30N4O8 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [2-[amino-[hydrazinyl(methyl)amino]methyl]-3,5-dibenzoyloxy-6-hydroxyoxan-4-yl] benzoate |
| SMILES | CN(NN)C(N)C1OC(O)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H30N4O8/c1-32(31-30)24(29)22-20(37-25(33)17-11-5-2-6-12-17)21(38-26(34)18-13-7-3-8-14-18)23(28(36)39-22)40-27(35)19-15-9-4-10-16-19/h2-16,20-24,28,31,36H,29-30H2,1H3 |
| InChIKey | GHAOOJHUMWNOPS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 175.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|