C20H28S — CID 91124349
di(cyclohexa-1,5-dien-1-yl)-methyl-(2-methylcyclohex-3-en-1-yl)-λ4-sulfane (PubChem CID 91124349) has the molecular formula C20H28S and a molecular weight of 300.51 g/mol. Its IUPAC name is di(cyclohexa-1,5-dien-1-yl)-methyl-(2-methylcyclohex-3-en-1-yl)-λ4-sulfane.
| Compound Name | di(cyclohexa-1,5-dien-1-yl)-methyl-(2-methylcyclohex-3-en-1-yl)-λ4-sulfane |
|---|---|
| PubChem CID | 91124349 |
| Molecular Formula | C20H28S |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | di(cyclohexa-1,5-dien-1-yl)-methyl-(2-methylcyclohex-3-en-1-yl)-λ4-sulfane |
| SMILES | CC1C=CCCC1S(C)(C1=CCCC=C1)C1=CCCC=C1 |
| InChI | InChI=1S/C20H28S/c1-17-11-9-10-16-20(17)21(2,18-12-5-3-6-13-18)19-14-7-4-8-15-19/h5,7,9,11-15,17,20H,3-4,6,8,10,16H2,1-2H3 |
| InChIKey | ZWOMDVZGGLMMFY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|