C10H16S — CID 134945345
4-ethenyl-2-propan-2-yl-3,6-dihydro-2H-thiopyran (PubChem CID 134945345) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is 4-ethenyl-2-propan-2-yl-3,6-dihydro-2H-thiopyran.
| Compound Name | 4-ethenyl-2-propan-2-yl-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 134945345 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-ethenyl-2-propan-2-yl-3,6-dihydro-2H-thiopyran |
| SMILES | C=CC1=CCSC(C(C)C)C1 |
| InChI | InChI=1S/C10H16S/c1-4-9-5-6-11-10(7-9)8(2)3/h4-5,8,10H,1,6-7H2,2-3H3 |
| InChIKey | OHFPDSLADLSYGP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |