C26H26Cl2N2O4S — CID 91126179
3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione (PubChem CID 91126179) has the molecular formula C26H26Cl2N2O4S and a molecular weight of 533.48 g/mol. Its IUPAC name is 3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione.
| Compound Name | 3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 91126179 |
| Molecular Formula | C26H26Cl2N2O4S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 3-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ccc(Cl)cc4[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C26H26Cl2N2O4S/c1-33-22-9-6-15(12-18(22)28)10-11-26(16-4-2-3-5-16)14-21(31)23(24(32)34-26)35-25-29-19-8-7-17(27)13-20(19)30-25/h6-9,12-13,16,23H,2-5,10-11,14H2,1H3,(H,29,30) |
| InChIKey | VQTSEDPVXAXVRJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|