C28H32N4O4 — CID 91126871
benzyl 4-[2-[2-methyl-5-(phenylcarbamoylamino)phenoxy]ethyl]piperazine-1-carboxylate (PubChem CID 91126871) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is benzyl 4-[2-[2-methyl-5-(phenylcarbamoylamino)phenoxy]ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-[2-methyl-5-(phenylcarbamoylamino)phenoxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91126871 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | benzyl 4-[2-[2-methyl-5-(phenylcarbamoylamino)phenoxy]ethyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2)cc1OCCN1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N4O4/c1-22-12-13-25(30-27(33)29-24-10-6-3-7-11-24)20-26(22)35-19-18-31-14-16-32(17-15-31)28(34)36-21-23-8-4-2-5-9-23/h2-13,20H,14-19,21H2,1H3,(H2,29,30,33) |
| InChIKey | YUFMQJJZDOPQIZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |