C10H11N5 — CID 91129434
N-(6-methyl-5H-1,2,4-triazin-4-yl)-1-pyridin-3-ylmethanimine (PubChem CID 91129434) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is N-(6-methyl-5H-1,2,4-triazin-4-yl)-1-pyridin-3-ylmethanimine.
| Compound Name | N-(6-methyl-5H-1,2,4-triazin-4-yl)-1-pyridin-3-ylmethanimine |
|---|---|
| PubChem CID | 91129434 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-(6-methyl-5H-1,2,4-triazin-4-yl)-1-pyridin-3-ylmethanimine |
| SMILES | CC1=NN=CN(N=Cc2cccnc2)C1 |
| InChI | InChI=1S/C10H11N5/c1-9-7-15(8-12-14-9)13-6-10-3-2-4-11-5-10/h2-6,8H,7H2,1H3 |
| InChIKey | UPZAZAKHEAOYBN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|