C22H27FN5O2+ — CID 91130376
3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-b][1,2,4]triazin-4-ium 4-oxide (PubChem CID 91130376) has the molecular formula C22H27FN5O2+ and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-b][1,2,4]triazin-4-ium 4-oxide.
| Compound Name | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-b][1,2,4]triazin-4-ium 4-oxide |
|---|---|
| PubChem CID | 91130376 |
| Molecular Formula | C22H27FN5O2+ |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-b][1,2,4]triazin-4-ium 4-oxide |
| SMILES | Cc1nc2n([n+](=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2 |
| InChI | InChI=1S/C22H27FN5O2/c1-15-19(28(29)27-10-3-2-4-21(27)24-15)9-13-26-11-7-16(8-12-26)22-18-6-5-17(23)14-20(18)30-25-22/h5-6,14,16H,2-4,7-13H2,1H3/q+1 |
| InChIKey | HBOVQDUYLNAZRZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|