C23H25FN2O4S — CID 91130428
4-[3-butoxy-4-(1-fluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)anilino]benzoic acid (PubChem CID 91130428) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-[3-butoxy-4-(1-fluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)anilino]benzoic acid.
| Compound Name | 4-[3-butoxy-4-(1-fluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 91130428 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-[3-butoxy-4-(1-fluoroethoxy)-N-(1,3-thiazol-5-ylmethyl)anilino]benzoic acid |
| SMILES | CCCCOc1cc(N(Cc2cncs2)c2ccc(C(=O)O)cc2)ccc1OC(C)F |
| InChI | InChI=1S/C23H25FN2O4S/c1-3-4-11-29-22-12-19(9-10-21(22)30-16(2)24)26(14-20-13-25-15-31-20)18-7-5-17(6-8-18)23(27)28/h5-10,12-13,15-16H,3-4,11,14H2,1-2H3,(H,27,28) |
| InChIKey | HMCYRXCHJHNEEO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|