C35H44N4O3S — CID 91132737
3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9,11-dimethyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide (PubChem CID 91132737) has the molecular formula C35H44N4O3S and a molecular weight of 600.83 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9,11-dimethyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9,11-dimethyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 91132737 |
| Molecular Formula | C35H44N4O3S |
| Molecular Weight | 600.83 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9,11-dimethyl-10-thia-1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCc1cn2c3c(cc(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNC(C)(C)c4cccc(OC)c4)cc13)N(C)SC(C)C2 |
| InChI | InChI=1S/C35H44N4O3S/c1-7-25-22-39-21-23(2)43-38(5)31-18-26(17-29(25)33(31)39)34(41)37-30(16-24-12-9-8-10-13-24)32(40)20-36-35(3,4)27-14-11-15-28(19-27)42-6/h8-15,17-19,22-23,30,32,36,40H,7,16,20-21H2,1-6H3,(H,37,41)/t23?,30-,32+/m0/s1 |
| InChIKey | WALRQZCKNCBSLL-RKNVHVRCSA-N |
| XLogP | 5.93 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.83 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|