C33H40N4O3S — CID 90950492
3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide (PubChem CID 90950492) has the molecular formula C33H40N4O3S and a molecular weight of 572.78 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 90950492 |
| Molecular Formula | C33H40N4O3S |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-[2-(3-methoxyphenyl)propan-2-ylamino]-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
| SMILES | CCc1cn2c3c(cc(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNC(C)(C)c4cccc(OC)c4)cc13)N(C)SC2 |
| InChI | InChI=1S/C33H40N4O3S/c1-6-23-20-37-21-41-36(4)29-17-24(16-27(23)31(29)37)32(39)35-28(15-22-11-8-7-9-12-22)30(38)19-34-33(2,3)25-13-10-14-26(18-25)40-5/h7-14,16-18,20,28,30,34,38H,6,15,19,21H2,1-5H3,(H,35,39)/t28-,30+/m0/s1 |
| InChIKey | BKFLOLSKXMDCTE-MFMCTBQISA-N |
| XLogP | 5.49 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|