C24H30N4O2S — CID 91337638
3-ethyl-N-[(2S,3R)-3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-7-carboxamide (PubChem CID 91337638) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-7-carboxamide.
| Compound Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 91337638 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-ethyl-N-[(2S,3R)-3-hydroxy-4-(methylamino)-1-phenylbutan-2-yl]-9-methyl-10-thia-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-7-carboxamide |
| SMILES | CCc1cn2c3c(c(C(=O)N[C@@H](Cc4ccccc4)[C@H](O)CNC)ccc13)N(C)SC2 |
| InChI | InChI=1S/C24H30N4O2S/c1-4-17-14-28-15-31-27(3)22-19(11-10-18(17)23(22)28)24(30)26-20(21(29)13-25-2)12-16-8-6-5-7-9-16/h5-11,14,20-21,25,29H,4,12-13,15H2,1-3H3,(H,26,30)/t20-,21+/m0/s1 |
| InChIKey | WQXCNZVYYQIFBM-LEWJYISDSA-N |
| XLogP | 3.18 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|