C33H34N4O3 — CID 91133841
N-(1-benzylpiperidin-4-yl)-4-[methyl-[(3-phenoxyphenyl)carbamoyl]amino]benzamide (PubChem CID 91133841) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-[methyl-[(3-phenoxyphenyl)carbamoyl]amino]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-[methyl-[(3-phenoxyphenyl)carbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 91133841 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-[methyl-[(3-phenoxyphenyl)carbamoyl]amino]benzamide |
| SMILES | CN(C(=O)Nc1cccc(Oc2ccccc2)c1)c1ccc(C(=O)NC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H34N4O3/c1-36(33(39)35-28-11-8-14-31(23-28)40-30-12-6-3-7-13-30)29-17-15-26(16-18-29)32(38)34-27-19-21-37(22-20-27)24-25-9-4-2-5-10-25/h2-18,23,27H,19-22,24H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | XDFCIWRGKWWPIR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |