C35H38N4O3 — CID 58730707
4-[(4-benzylphenyl)carbamoyl-methylamino]-N-(1-benzylpiperidin-4-yl)-2-methoxybenzamide (PubChem CID 58730707) has the molecular formula C35H38N4O3 and a molecular weight of 562.71 g/mol. Its IUPAC name is 4-[(4-benzylphenyl)carbamoyl-methylamino]-N-(1-benzylpiperidin-4-yl)-2-methoxybenzamide.
| Compound Name | 4-[(4-benzylphenyl)carbamoyl-methylamino]-N-(1-benzylpiperidin-4-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 58730707 |
| Molecular Formula | C35H38N4O3 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 4-[(4-benzylphenyl)carbamoyl-methylamino]-N-(1-benzylpiperidin-4-yl)-2-methoxybenzamide |
| SMILES | COc1cc(N(C)C(=O)Nc2ccc(Cc3ccccc3)cc2)ccc1C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C35H38N4O3/c1-38(35(41)37-29-15-13-27(14-16-29)23-26-9-5-3-6-10-26)31-17-18-32(33(24-31)42-2)34(40)36-30-19-21-39(22-20-30)25-28-11-7-4-8-12-28/h3-18,24,30H,19-23,25H2,1-2H3,(H,36,40)(H,37,41) |
| InChIKey | GLJOZXHFQOZMPA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |