C24H34O2 — CID 91134327
[(1R,2R,3S,4R,6S,7R,8S)-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] adamantane-1-carboxylate (PubChem CID 91134327) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is [(1R,2R,3S,4R,6S,7R,8S)-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] adamantane-1-carboxylate.
| Compound Name | [(1R,2R,3S,4R,6S,7R,8S)-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 91134327 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(1R,2R,3S,4R,6S,7R,8S)-4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] adamantane-1-carboxylate |
| SMILES | C[C@@]1(OC(=O)C23CC4CC(CC(C4)C2)C3)C[C@@H]2C[C@H]1[C@@H]1[C@@H]3CC[C@@H](C3)[C@H]21 |
| InChI | InChI=1S/C24H34O2/c1-23(12-18-8-19(23)21-17-3-2-16(7-17)20(18)21)26-22(25)24-9-13-4-14(10-24)6-15(5-13)11-24/h13-21H,2-12H2,1H3/t13?,14?,15?,16-,17+,18-,19-,20+,21-,23+,24?/m0/s1 |
| InChIKey | CAIJVJQYIUSRMZ-BOEGUSFHSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|