C20H21N5O3 — CID 9113445
ethyl N-[2-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]acetyl]carbamate (PubChem CID 9113445) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl N-[2-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]acetyl]carbamate |
|---|---|
| PubChem CID | 9113445 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | ethyl N-[2-[ethyl-(2-pyridin-3-ylquinazolin-4-yl)amino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)c1nc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C20H21N5O3/c1-3-25(13-17(26)23-20(27)28-4-2)19-15-9-5-6-10-16(15)22-18(24-19)14-8-7-11-21-12-14/h5-12H,3-4,13H2,1-2H3,(H,23,26,27) |
| InChIKey | FBXJVVMPYZMPAB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |